C10H10F2O2 — CID 144529056
4-cyclopropyl-1,2-difluorobenzene;formic acid (PubChem CID 144529056) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 4-cyclopropyl-1,2-difluorobenzene;formic acid.
| Compound Name | 4-cyclopropyl-1,2-difluorobenzene;formic acid |
|---|---|
| PubChem CID | 144529056 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-cyclopropyl-1,2-difluorobenzene;formic acid |
| SMILES | Fc1ccc(C2CC2)cc1F.O=CO |
| InChI | InChI=1S/C9H8F2.CH2O2/c10-8-4-3-7(5-9(8)11)6-1-2-6;2-1-3/h3-6H,1-2H2;1H,(H,2,3) |
| InChIKey | RUZIWMRUOUXKGH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|