C17H20F2O2 — CID 139645779
[4-(3,4-difluorophenyl)cyclohexyl] pent-4-enoate (PubChem CID 139645779) has the molecular formula C17H20F2O2 and a molecular weight of 294.34 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)cyclohexyl] pent-4-enoate.
| Compound Name | [4-(3,4-difluorophenyl)cyclohexyl] pent-4-enoate |
|---|---|
| PubChem CID | 139645779 |
| Molecular Formula | C17H20F2O2 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [4-(3,4-difluorophenyl)cyclohexyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC1CCC(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H20F2O2/c1-2-3-4-17(20)21-14-8-5-12(6-9-14)13-7-10-15(18)16(19)11-13/h2,7,10-12,14H,1,3-6,8-9H2 |
| InChIKey | AXIVZOIINRJJMK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|