C18H21F3O3 — CID 139645778
[4-[4-(trifluoromethoxy)phenyl]cyclohexyl] pent-4-enoate (PubChem CID 139645778) has the molecular formula C18H21F3O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is [4-[4-(trifluoromethoxy)phenyl]cyclohexyl] pent-4-enoate.
| Compound Name | [4-[4-(trifluoromethoxy)phenyl]cyclohexyl] pent-4-enoate |
|---|---|
| PubChem CID | 139645778 |
| Molecular Formula | C18H21F3O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [4-[4-(trifluoromethoxy)phenyl]cyclohexyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H21F3O3/c1-2-3-4-17(22)23-15-9-5-13(6-10-15)14-7-11-16(12-8-14)24-18(19,20)21/h2,7-8,11-13,15H,1,3-6,9-10H2 |
| InChIKey | RSRBFUKUVZNAPL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|