C17H19F3O3 — CID 67844168
(E)-4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-enoic acid (PubChem CID 67844168) has the molecular formula C17H19F3O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is (E)-4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-enoic acid.
| Compound Name | (E)-4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-enoic acid |
|---|---|
| PubChem CID | 67844168 |
| Molecular Formula | C17H19F3O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (E)-4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CC1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H19F3O3/c18-17(19,20)23-15-10-8-14(9-11-15)13-6-4-12(5-7-13)2-1-3-16(21)22/h1,3,8-13H,2,4-7H2,(H,21,22)/b3-1+ |
| InChIKey | NYPDBLVBXZLUNL-HNQUOIGGSA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|