C19H26O2 — CID 67642965
(E)-4-[4-(4-propylphenyl)cyclohexyl]but-2-enoic acid (PubChem CID 67642965) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (E)-4-[4-(4-propylphenyl)cyclohexyl]but-2-enoic acid.
| Compound Name | (E)-4-[4-(4-propylphenyl)cyclohexyl]but-2-enoic acid |
|---|---|
| PubChem CID | 67642965 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (E)-4-[4-(4-propylphenyl)cyclohexyl]but-2-enoic acid |
| SMILES | CCCc1ccc(C2CCC(C/C=C/C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C19H26O2/c1-2-4-15-7-11-17(12-8-15)18-13-9-16(10-14-18)5-3-6-19(20)21/h3,6-8,11-12,16,18H,2,4-5,9-10,13-14H2,1H3,(H,20,21)/b6-3+ |
| InChIKey | GJRCSDWIMYBAIV-ZZXKWVIFSA-N |
| XLogP | 4.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|