C20H28O2 — CID 67642998
(E)-4-[4-(4-propylphenyl)cyclohexyl]pent-2-enoic acid (PubChem CID 67642998) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (E)-4-[4-(4-propylphenyl)cyclohexyl]pent-2-enoic acid.
| Compound Name | (E)-4-[4-(4-propylphenyl)cyclohexyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 67642998 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (E)-4-[4-(4-propylphenyl)cyclohexyl]pent-2-enoic acid |
| SMILES | CCCc1ccc(C2CCC(C(C)/C=C/C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C20H28O2/c1-3-4-16-6-8-18(9-7-16)19-12-10-17(11-13-19)15(2)5-14-20(21)22/h5-9,14-15,17,19H,3-4,10-13H2,1-2H3,(H,21,22)/b14-5+ |
| InChIKey | QCURXZOBSZIEKR-LHHJGKSTSA-N |
| XLogP | 5.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|