C18H24F2O2 — CID 18659034
2,2-difluoroethyl 4-(4-propylphenyl)cyclohexane-1-carboxylate (PubChem CID 18659034) has the molecular formula C18H24F2O2 and a molecular weight of 310.38 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-(4-propylphenyl)cyclohexane-1-carboxylate.
| Compound Name | 2,2-difluoroethyl 4-(4-propylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18659034 |
| Molecular Formula | C18H24F2O2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2,2-difluoroethyl 4-(4-propylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCc1ccc(C2CCC(C(=O)OCC(F)F)CC2)cc1 |
| InChI | InChI=1S/C18H24F2O2/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)18(21)22-12-17(19)20/h4-7,15-17H,2-3,8-12H2,1H3 |
| InChIKey | KIDRKZZVLBMFEF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |