C19H31NO2 — CID 142495341
ethane;ethyl 4-[4-(methylaminomethyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 142495341) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is ethane;ethyl 4-[4-(methylaminomethyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | ethane;ethyl 4-[4-(methylaminomethyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142495341 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | ethane;ethyl 4-[4-(methylaminomethyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | CC.CCOC(=O)C1CCC(c2ccc(CNC)cc2)CC1 |
| InChI | InChI=1S/C17H25NO2.C2H6/c1-3-20-17(19)16-10-8-15(9-11-16)14-6-4-13(5-7-14)12-18-2;1-2/h4-7,15-16,18H,3,8-12H2,1-2H3;1-2H3 |
| InChIKey | PIBWHFBRCXCQJQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |