C27H39N3O6 — CID 67844071
tert-butyl 4-[4-[[(4-ethoxycarbonylcyclohexanecarbonyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate (PubChem CID 67844071) has the molecular formula C27H39N3O6 and a molecular weight of 501.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(4-ethoxycarbonylcyclohexanecarbonyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(4-ethoxycarbonylcyclohexanecarbonyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67844071 |
| Molecular Formula | C27H39N3O6 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | tert-butyl 4-[4-[[(4-ethoxycarbonylcyclohexanecarbonyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(C(=O)NNC(=O)c2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H39N3O6/c1-5-35-25(33)22-12-10-21(11-13-22)24(32)29-28-23(31)20-8-6-18(7-9-20)19-14-16-30(17-15-19)26(34)36-27(2,3)4/h6-9,19,21-22H,5,10-17H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | GOTKYOOUAWHIPI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|