C18H28N4O2 — CID 144572137
tert-butyl 4-[4-[(N'-methylcarbamimidoyl)amino]phenyl]piperidine-1-carboxylate (PubChem CID 144572137) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is tert-butyl 4-[4-[(N'-methylcarbamimidoyl)amino]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(N'-methylcarbamimidoyl)amino]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144572137 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl 4-[4-[(N'-methylcarbamimidoyl)amino]phenyl]piperidine-1-carboxylate |
| SMILES | C/N=C(\N)Nc1ccc(C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H28N4O2/c1-18(2,3)24-17(23)22-11-9-14(10-12-22)13-5-7-15(8-6-13)21-16(19)20-4/h5-8,14H,9-12H2,1-4H3,(H3,19,20,21) |
| InChIKey | KQGZQPMOEUSTOX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|