C25H33N3O4 — CID 69452252
tert-butyl 4-[4-[(3-ethoxyphenyl)carbamoylamino]phenyl]piperidine-1-carboxylate (PubChem CID 69452252) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3-ethoxyphenyl)carbamoylamino]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3-ethoxyphenyl)carbamoylamino]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69452252 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | tert-butyl 4-[4-[(3-ethoxyphenyl)carbamoylamino]phenyl]piperidine-1-carboxylate |
| SMILES | CCOc1cccc(NC(=O)Nc2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C25H33N3O4/c1-5-31-22-8-6-7-21(17-22)27-23(29)26-20-11-9-18(10-12-20)19-13-15-28(16-14-19)24(30)32-25(2,3)4/h6-12,17,19H,5,13-16H2,1-4H3,(H2,26,27,29) |
| InChIKey | YWQJSSIRFRGDQO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |