C22H26N2O4 — CID 175718295
tert-butyl (3R)-3-[4-(phenoxycarbonylamino)phenyl]pyrrolidine-1-carboxylate (PubChem CID 175718295) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-(phenoxycarbonylamino)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-(phenoxycarbonylamino)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175718295 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | tert-butyl (3R)-3-[4-(phenoxycarbonylamino)phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](c2ccc(NC(=O)Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H26N2O4/c1-22(2,3)28-21(26)24-14-13-17(15-24)16-9-11-18(12-10-16)23-20(25)27-19-7-5-4-6-8-19/h4-12,17H,13-15H2,1-3H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | KRTXHTRXKHXOTD-KRWDZBQOSA-N |
| XLogP | 5.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |