C24H32INO4 — CID 176960937
tert-butyl formate;phenyl N-(4-cyclohexylphenyl)carbamate;hydroiodide (PubChem CID 176960937) has the molecular formula C24H32INO4 and a molecular weight of 525.43 g/mol. Its IUPAC name is tert-butyl formate;phenyl N-(4-cyclohexylphenyl)carbamate;hydroiodide.
| Compound Name | tert-butyl formate;phenyl N-(4-cyclohexylphenyl)carbamate;hydroiodide |
|---|---|
| PubChem CID | 176960937 |
| Molecular Formula | C24H32INO4 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | tert-butyl formate;phenyl N-(4-cyclohexylphenyl)carbamate;hydroiodide |
| SMILES | CC(C)(C)OC=O.I.O=C(Nc1ccc(C2CCCCC2)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C19H21NO2.C5H10O2.HI/c21-19(22-18-9-5-2-6-10-18)20-17-13-11-16(12-14-17)15-7-3-1-4-8-15;1-5(2,3)7-4-6;/h2,5-6,9-15H,1,3-4,7-8H2,(H,20,21);4H,1-3H3;1H |
| InChIKey | UWGKTVCKKPSFIE-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|