C25H27NO4 — CID 143736672
N-(4-cyclohexylphenyl)-6-methoxynaphthalene-2-carboxamide;formic acid (PubChem CID 143736672) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-6-methoxynaphthalene-2-carboxamide;formic acid.
| Compound Name | N-(4-cyclohexylphenyl)-6-methoxynaphthalene-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 143736672 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-(4-cyclohexylphenyl)-6-methoxynaphthalene-2-carboxamide;formic acid |
| SMILES | COc1ccc2cc(C(=O)Nc3ccc(C4CCCCC4)cc3)ccc2c1.O=CO |
| InChI | InChI=1S/C24H25NO2.CH2O2/c1-27-23-14-11-19-15-21(8-7-20(19)16-23)24(26)25-22-12-9-18(10-13-22)17-5-3-2-4-6-17;2-1-3/h7-17H,2-6H2,1H3,(H,25,26);1H,(H,2,3) |
| InChIKey | NEYADRZOEXQOFI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|