C29H29NO3 — CID 4831195
N-[3-[3-(4-cyclohexylphenyl)-3-oxoprop-1-enyl]phenyl]-4-methoxybenzamide (PubChem CID 4831195) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[3-[3-(4-cyclohexylphenyl)-3-oxoprop-1-enyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[3-[3-(4-cyclohexylphenyl)-3-oxoprop-1-enyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4831195 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[3-[3-(4-cyclohexylphenyl)-3-oxoprop-1-enyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C=CC(=O)c3ccc(C4CCCCC4)cc3)c2)cc1 |
| InChI | InChI=1S/C29H29NO3/c1-33-27-17-15-25(16-18-27)29(32)30-26-9-5-6-21(20-26)10-19-28(31)24-13-11-23(12-14-24)22-7-3-2-4-8-22/h5-6,9-20,22H,2-4,7-8H2,1H3,(H,30,32) |
| InChIKey | XTFSPLAWAJLSRN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|