C21H20Cl2O — CID 23508869
(E)-1-(4-cyclohexylphenyl)-3-(3,5-dichlorophenyl)prop-2-en-1-one (PubChem CID 23508869) has the molecular formula C21H20Cl2O and a molecular weight of 359.30 g/mol. Its IUPAC name is (E)-1-(4-cyclohexylphenyl)-3-(3,5-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-cyclohexylphenyl)-3-(3,5-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 23508869 |
| Molecular Formula | C21H20Cl2O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (E)-1-(4-cyclohexylphenyl)-3-(3,5-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Cl)cc(Cl)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H20Cl2O/c22-19-12-15(13-20(23)14-19)6-11-21(24)18-9-7-17(8-10-18)16-4-2-1-3-5-16/h6-14,16H,1-5H2/b11-6+ |
| InChIKey | DRVQOMXOJPYTLG-IZZDOVSWSA-N |
| XLogP | 6.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|