C26H26N2O3 — CID 155133623
3-[[4-(4-cyclohexylanilino)benzoyl]amino]benzoic acid (PubChem CID 155133623) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-[[4-(4-cyclohexylanilino)benzoyl]amino]benzoic acid.
| Compound Name | 3-[[4-(4-cyclohexylanilino)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 155133623 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[[4-(4-cyclohexylanilino)benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2ccc(Nc3ccc(C4CCCCC4)cc3)cc2)c1 |
| InChI | InChI=1S/C26H26N2O3/c29-25(28-24-8-4-7-21(17-24)26(30)31)20-11-15-23(16-12-20)27-22-13-9-19(10-14-22)18-5-2-1-3-6-18/h4,7-18,27H,1-3,5-6H2,(H,28,29)(H,30,31) |
| InChIKey | IGQLMHYDZBHFJS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |