C30H30N2O3 — CID 155133864
3-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]benzoic acid (PubChem CID 155133864) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]benzoic acid.
| Compound Name | 3-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 155133864 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 3-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2ccc(C(=O)Nc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cc2)c1 |
| InChI | InChI=1S/C30H30N2O3/c33-28(22-4-8-25(9-5-22)31-27-3-1-2-23(15-27)29(34)35)32-26-10-6-24(7-11-26)30-16-19-12-20(17-30)14-21(13-19)18-30/h1-11,15,19-21,31H,12-14,16-18H2,(H,32,33)(H,34,35) |
| InChIKey | DBKIBYLVKGRHNF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |