C31H34N2O3 — CID 155697350
3-[[3-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]benzoyl]amino]benzoic acid (PubChem CID 155697350) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is 3-[[3-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]benzoyl]amino]benzoic acid.
| Compound Name | 3-[[3-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 155697350 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 3-[[3-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]benzoyl]amino]benzoic acid |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3cccc(C(=O)Nc4cccc(C(=O)O)c4)c3)cc1)C2 |
| InChI | InChI=1S/C31H34N2O3/c1-20-13-21-15-22(14-20)19-31(2,18-21)25-9-11-26(12-10-25)32-27-7-3-5-23(16-27)29(34)33-28-8-4-6-24(17-28)30(35)36/h3-12,16-17,20-22,32H,13-15,18-19H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | ZZVRLTCIJDNUCK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |