C32H41ClN2O2 — CID 155696913
chloromethane;ethyl 1-[[4-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]methyl]pyrrole-2-carboxylate (PubChem CID 155696913) has the molecular formula C32H41ClN2O2 and a molecular weight of 521.15 g/mol. Its IUPAC name is chloromethane;ethyl 1-[[4-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]methyl]pyrrole-2-carboxylate.
| Compound Name | chloromethane;ethyl 1-[[4-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]methyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155696913 |
| Molecular Formula | C32H41ClN2O2 |
| Molecular Weight | 521.15 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | chloromethane;ethyl 1-[[4-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]methyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cccn1Cc1ccc(Nc2ccc(C3(C)CC4CC(C)CC(C4)C3)cc2)cc1.CCl |
| InChI | InChI=1S/C31H38N2O2.CH3Cl/c1-4-35-30(34)29-6-5-15-33(29)21-23-7-11-27(12-8-23)32-28-13-9-26(10-14-28)31(3)19-24-16-22(2)17-25(18-24)20-31;1-2/h5-15,22,24-25,32H,4,16-21H2,1-3H3;1H3 |
| InChIKey | ZEBZJZCJOGTXDW-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.15 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|