C13H19NO2 — CID 105422013
ethyl 1-(cyclopentylmethyl)pyrrole-2-carboxylate (PubChem CID 105422013) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is ethyl 1-(cyclopentylmethyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 1-(cyclopentylmethyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 105422013 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethyl 1-(cyclopentylmethyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cccn1CC1CCCC1 |
| InChI | InChI=1S/C13H19NO2/c1-2-16-13(15)12-8-5-9-14(12)10-11-6-3-4-7-11/h5,8-9,11H,2-4,6-7,10H2,1H3 |
| InChIKey | JJAFJAJJNPIRPV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |