C12H20N2O2 — CID 105422127
ethyl 1-[3-(dimethylamino)propyl]pyrrole-2-carboxylate (PubChem CID 105422127) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl 1-[3-(dimethylamino)propyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-[3-(dimethylamino)propyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 105422127 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | ethyl 1-[3-(dimethylamino)propyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cccn1CCCN(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-4-16-12(15)11-7-5-9-14(11)10-6-8-13(2)3/h5,7,9H,4,6,8,10H2,1-3H3 |
| InChIKey | KHMRYKWBJCDMLS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |