About ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate
ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate (PubChem CID 105422096) has the molecular formula C12H16F3NO3
and a molecular weight of 279.26 g/mol. Its IUPAC name is ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate |
| PubChem CID | 105422096 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cccn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3/c1-2-19-11(17)10-5-3-6-16(10)7-4-8-18-9-12(13,14)15/h3,5-6H,2,4,7-9H2,1H3 |
| InChIKey | YHHXAOAPMLCIBJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate?
The IUPAC name of ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate (CID 105422096) is ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate?
The canonical SMILES for ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate is CCOC(=O)c1cccn1CCCOCC(F)(F)F.
What is the InChIKey of ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate?
The InChIKey is YHHXAOAPMLCIBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO3/c1-2-19-11(17)10-5-3-6-16(10)7-4-8-18-9-12(13,14)15/h3,5-6H,2,4,7-9H2,1H3.
What are the key properties of ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate?
ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate has a molecular weight of 279.26 g/mol, XLogP of 2.63, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-2-carboxylate is sourced from PubChem (CID 105422096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).