C11H14F3NO2 — CID 114609431
butyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate (PubChem CID 114609431) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is butyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate.
| Compound Name | butyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114609431 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | butyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate |
| SMILES | CCCCOC(=O)c1cccn1CC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2/c1-2-3-7-17-10(16)9-5-4-6-15(9)8-11(12,13)14/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | VLYVNVCNSBVJSO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|