About 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate
6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate (PubChem CID 171341955) has the molecular formula C12H16F3NO2
and a molecular weight of 263.26 g/mol. Its IUPAC name is 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate |
| PubChem CID | 171341955 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCCCCCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO2/c1-16-8-5-6-10(16)11(17)18-9-4-2-3-7-12(13,14)15/h5-6,8H,2-4,7,9H2,1H3 |
| InChIKey | KOJJQXMVZSTVPZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate?
The IUPAC name of 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate (CID 171341955) is 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate.
What is the SMILES notation for 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate?
The canonical SMILES for 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate is Cn1cccc1C(=O)OCCCCCC(F)(F)F.
What is the InChIKey of 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate?
The InChIKey is KOJJQXMVZSTVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO2/c1-16-8-5-6-10(16)11(17)18-9-4-2-3-7-12(13,14)15/h5-6,8H,2-4,7,9H2,1H3.
What are the key properties of 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate?
6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate has a molecular weight of 263.26 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6,6-trifluorohexyl 1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 171341955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).