C11H12F3NO3 — CID 86781463
4,4,4-trifluorobutyl 1-methyl-6-oxopyridine-3-carboxylate (PubChem CID 86781463) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is 4,4,4-trifluorobutyl 1-methyl-6-oxopyridine-3-carboxylate.
| Compound Name | 4,4,4-trifluorobutyl 1-methyl-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 86781463 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4,4,4-trifluorobutyl 1-methyl-6-oxopyridine-3-carboxylate |
| SMILES | Cn1cc(C(=O)OCCCC(F)(F)F)ccc1=O |
| InChI | InChI=1S/C11H12F3NO3/c1-15-7-8(3-4-9(15)16)10(17)18-6-2-5-11(12,13)14/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | FEKJZVPFRMOTAR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|