C11H11F3O4 — CID 146939193
4-(4,4,4-trifluorobutoxy)benzenecarboperoxoic acid (PubChem CID 146939193) has the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutoxy)benzenecarboperoxoic acid.
| Compound Name | 4-(4,4,4-trifluorobutoxy)benzenecarboperoxoic acid |
|---|---|
| PubChem CID | 146939193 |
| Molecular Formula | C11H11F3O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-(4,4,4-trifluorobutoxy)benzenecarboperoxoic acid |
| SMILES | O=C(OO)c1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O4/c12-11(13,14)6-1-7-17-9-4-2-8(3-5-9)10(15)18-16/h2-5,16H,1,6-7H2 |
| InChIKey | AGNLRAYIQBYNIH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|