C15H19F3O2 — CID 105123323
1-(4-butoxyphenyl)-5,5,5-trifluoropentan-1-one (PubChem CID 105123323) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(4-butoxyphenyl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 105123323 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(4-butoxyphenyl)-5,5,5-trifluoropentan-1-one |
| SMILES | CCCCOc1ccc(C(=O)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3O2/c1-2-3-11-20-13-8-6-12(7-9-13)14(19)5-4-10-15(16,17)18/h6-9H,2-5,10-11H2,1H3 |
| InChIKey | NWMVJEGYNTUANO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|