C14H17F3O2 — CID 105106823
1-(4-butoxyphenyl)-4,4,4-trifluorobutan-1-one (PubChem CID 105106823) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(4-butoxyphenyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 105106823 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-(4-butoxyphenyl)-4,4,4-trifluorobutan-1-one |
| SMILES | CCCCOc1ccc(C(=O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O2/c1-2-3-10-19-12-6-4-11(5-7-12)13(18)8-9-14(15,16)17/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | AUHUUJRIDUHWRM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|