C13H16F3NO2 — CID 78786044
4-butoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 78786044) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 4-butoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-butoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 78786044 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-butoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO2/c1-2-3-8-19-11-6-4-10(5-7-11)12(18)17-9-13(14,15)16/h4-7H,2-3,8-9H2,1H3,(H,17,18) |
| InChIKey | QSQGPFCNUNYDHH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|