C21H23F3N2O3 — CID 55785183
3-[(4-butoxybenzoyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 55785183) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 3-[(4-butoxybenzoyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[(4-butoxybenzoyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 55785183 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 3-[(4-butoxybenzoyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc(C(=O)NCC(F)(F)F)ccc2C)cc1 |
| InChI | InChI=1S/C21H23F3N2O3/c1-3-4-11-29-17-9-7-15(8-10-17)20(28)26-18-12-16(6-5-14(18)2)19(27)25-13-21(22,23)24/h5-10,12H,3-4,11,13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | IRIVXRWHQXWTPD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|