C28H40N2O4S — CID 19813902
3-[(4-decoxybenzoyl)amino]-4-methyl-N-(2-methylsulfinylethyl)benzamide (PubChem CID 19813902) has the molecular formula C28H40N2O4S and a molecular weight of 500.71 g/mol. Its IUPAC name is 3-[(4-decoxybenzoyl)amino]-4-methyl-N-(2-methylsulfinylethyl)benzamide.
| Compound Name | 3-[(4-decoxybenzoyl)amino]-4-methyl-N-(2-methylsulfinylethyl)benzamide |
|---|---|
| PubChem CID | 19813902 |
| Molecular Formula | C28H40N2O4S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 3-[(4-decoxybenzoyl)amino]-4-methyl-N-(2-methylsulfinylethyl)benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2cc(C(=O)NCCS(C)=O)ccc2C)cc1 |
| InChI | InChI=1S/C28H40N2O4S/c1-4-5-6-7-8-9-10-11-19-34-25-16-14-23(15-17-25)28(32)30-26-21-24(13-12-22(26)2)27(31)29-18-20-35(3)33/h12-17,21H,4-11,18-20H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | RWURNMPEVIPRNX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|