C16H22F3N3O2 — CID 47064089
3-[[2-(butylamino)-2-oxoethyl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 47064089) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 3-[[2-(butylamino)-2-oxoethyl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[[2-(butylamino)-2-oxoethyl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 47064089 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-[[2-(butylamino)-2-oxoethyl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCNC(=O)CNc1cc(C(=O)NCC(F)(F)F)ccc1C |
| InChI | InChI=1S/C16H22F3N3O2/c1-3-4-7-20-14(23)9-21-13-8-12(6-5-11(13)2)15(24)22-10-16(17,18)19/h5-6,8,21H,3-4,7,9-10H2,1-2H3,(H,20,23)(H,22,24) |
| InChIKey | OODUBRZWIXLUDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|