C13H20N2O — CID 43726955
3-(butylamino)-N,4-dimethylbenzamide (PubChem CID 43726955) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-(butylamino)-N,4-dimethylbenzamide.
| Compound Name | 3-(butylamino)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 43726955 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-(butylamino)-N,4-dimethylbenzamide |
| SMILES | CCCCNc1cc(C(=O)NC)ccc1C |
| InChI | InChI=1S/C13H20N2O/c1-4-5-8-15-12-9-11(13(16)14-3)7-6-10(12)2/h6-7,9,15H,4-5,8H2,1-3H3,(H,14,16) |
| InChIKey | UMMMVTXJHFCMTP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|