C14H22N2O — CID 61325560
3-(2,2-dimethylpropylamino)-N,4-dimethylbenzamide (PubChem CID 61325560) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylamino)-N,4-dimethylbenzamide.
| Compound Name | 3-(2,2-dimethylpropylamino)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 61325560 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 3-(2,2-dimethylpropylamino)-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(NCC(C)(C)C)c1 |
| InChI | InChI=1S/C14H22N2O/c1-10-6-7-11(13(17)15-5)8-12(10)16-9-14(2,3)4/h6-8,16H,9H2,1-5H3,(H,15,17) |
| InChIKey | SUOLERZPXGPHPV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |