C14H15BrN2OS — CID 43726901
3-[(5-bromothiophen-2-yl)methylamino]-N,4-dimethylbenzamide (PubChem CID 43726901) has the molecular formula C14H15BrN2OS and a molecular weight of 339.26 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)methylamino]-N,4-dimethylbenzamide.
| Compound Name | 3-[(5-bromothiophen-2-yl)methylamino]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 43726901 |
| Molecular Formula | C14H15BrN2OS |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)methylamino]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(NCc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C14H15BrN2OS/c1-9-3-4-10(14(18)16-2)7-12(9)17-8-11-5-6-13(15)19-11/h3-7,17H,8H2,1-2H3,(H,16,18) |
| InChIKey | AQXMDFHCZSDGSV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |