C14H14BrClN2OS — CID 102833731
4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-N,3-dimethylbenzamide (PubChem CID 102833731) has the molecular formula C14H14BrClN2OS and a molecular weight of 373.70 g/mol. Its IUPAC name is 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-N,3-dimethylbenzamide.
| Compound Name | 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 102833731 |
| Molecular Formula | C14H14BrClN2OS |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-N,3-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(NCc2cc(Br)c(Cl)s2)c(C)c1 |
| InChI | InChI=1S/C14H14BrClN2OS/c1-8-5-9(14(19)17-2)3-4-12(8)18-7-10-6-11(15)13(16)20-10/h3-6,18H,7H2,1-2H3,(H,17,19) |
| InChIKey | JMALLQVLBXAQHT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |