C14H15BrN2O2 — CID 43740112
4-[(5-bromofuran-2-yl)methylamino]-N,3-dimethylbenzamide (PubChem CID 43740112) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 4-[(5-bromofuran-2-yl)methylamino]-N,3-dimethylbenzamide.
| Compound Name | 4-[(5-bromofuran-2-yl)methylamino]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 43740112 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-[(5-bromofuran-2-yl)methylamino]-N,3-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(NCc2ccc(Br)o2)c(C)c1 |
| InChI | InChI=1S/C14H15BrN2O2/c1-9-7-10(14(18)16-2)3-5-12(9)17-8-11-4-6-13(15)19-11/h3-7,17H,8H2,1-2H3,(H,16,18) |
| InChIKey | HQAVGVAIOLLWEI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |