C14H14BrN3O4 — CID 133375131
4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzamide (PubChem CID 133375131) has the molecular formula C14H14BrN3O4 and a molecular weight of 368.19 g/mol. Its IUPAC name is 4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 133375131 |
| Molecular Formula | C14H14BrN3O4 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(NCCc2ccc(Br)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14BrN3O4/c1-16-14(19)9-2-4-11(12(8-9)18(20)21)17-7-6-10-3-5-13(15)22-10/h2-5,8,17H,6-7H2,1H3,(H,16,19) |
| InChIKey | JMDVSNZGWGOYRD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|