C13H14BrN3O5S — CID 133375156
4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 133375156) has the molecular formula C13H14BrN3O5S and a molecular weight of 404.24 g/mol. Its IUPAC name is 4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133375156 |
| Molecular Formula | C13H14BrN3O5S |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 4-[2-(5-bromofuran-2-yl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCc2ccc(Br)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14BrN3O5S/c1-15-23(20,21)10-3-4-11(12(8-10)17(18)19)16-7-6-9-2-5-13(14)22-9/h2-5,8,15-16H,6-7H2,1H3 |
| InChIKey | CVNWZAXQLIGDQP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|