C15H15F2N3O4S — CID 133302386
4-[2-(2,4-difluorophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 133302386) has the molecular formula C15H15F2N3O4S and a molecular weight of 371.37 g/mol. Its IUPAC name is 4-[2-(2,4-difluorophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(2,4-difluorophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133302386 |
| Molecular Formula | C15H15F2N3O4S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-[2-(2,4-difluorophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCc2ccc(F)cc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15F2N3O4S/c1-18-25(23,24)12-4-5-14(15(9-12)20(21)22)19-7-6-10-2-3-11(16)8-13(10)17/h2-5,8-9,18-19H,6-7H2,1H3 |
| InChIKey | JEEIJWXDYNAXTL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|