C15H13F2N3O2S — CID 71871110
3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide (PubChem CID 71871110) has the molecular formula C15H13F2N3O2S and a molecular weight of 337.35 g/mol. Its IUPAC name is 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide.
| Compound Name | 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 71871110 |
| Molecular Formula | C15H13F2N3O2S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide |
| SMILES | N#Cc1cc(S(N)(=O)=O)ccc1NCCc1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F2N3O2S/c16-12-2-1-10(14(17)8-12)5-6-20-15-4-3-13(23(19,21)22)7-11(15)9-18/h1-4,7-8,20H,5-6H2,(H2,19,21,22) |
| InChIKey | QKLIBWFFAQNBEO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |