About 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide
3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide (PubChem CID 71871110) has the molecular formula C15H13F2N3O2S
and a molecular weight of 337.35 g/mol. Its IUPAC name is 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide |
| PubChem CID | 71871110 |
| Molecular Formula | C15H13F2N3O2S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide |
| SMILES | N#Cc1cc(S(N)(=O)=O)ccc1NCCc1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F2N3O2S/c16-12-2-1-10(14(17)8-12)5-6-20-15-4-3-13(23(19,21)22)7-11(15)9-18/h1-4,7-8,20H,5-6H2,(H2,19,21,22) |
| InChIKey | QKLIBWFFAQNBEO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide?
The IUPAC name of 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide (CID 71871110) is 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide.
What is the SMILES notation for 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide?
The canonical SMILES for 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide is N#Cc1cc(S(N)(=O)=O)ccc1NCCc1ccc(F)cc1F.
What is the InChIKey of 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide?
The InChIKey is QKLIBWFFAQNBEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N3O2S/c16-12-2-1-10(14(17)8-12)5-6-20-15-4-3-13(23(19,21)22)7-11(15)9-18/h1-4,7-8,20H,5-6H2,(H2,19,21,22).
What are the key properties of 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide?
3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide has a molecular weight of 337.35 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-4-[2-(2,4-difluorophenyl)ethylamino]benzenesulfonamide is sourced from PubChem (CID 71871110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).