C14H12FN3O2S — CID 133310631
3-cyano-4-[(3-fluorophenyl)methylamino]benzenesulfonamide (PubChem CID 133310631) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-cyano-4-[(3-fluorophenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-cyano-4-[(3-fluorophenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 133310631 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-cyano-4-[(3-fluorophenyl)methylamino]benzenesulfonamide |
| SMILES | N#Cc1cc(S(N)(=O)=O)ccc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C14H12FN3O2S/c15-12-3-1-2-10(6-12)9-18-14-5-4-13(21(17,19)20)7-11(14)8-16/h1-7,18H,9H2,(H2,17,19,20) |
| InChIKey | DNIFDOLJTDRNQN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |