C14H13N3O2S — CID 122157812
3-[(4-cyanoanilino)methyl]benzenesulfonamide (PubChem CID 122157812) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[(4-cyanoanilino)methyl]benzenesulfonamide.
| Compound Name | 3-[(4-cyanoanilino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122157812 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-[(4-cyanoanilino)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(NCc2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C14H13N3O2S/c15-9-11-4-6-13(7-5-11)17-10-12-2-1-3-14(8-12)20(16,18)19/h1-8,17H,10H2,(H2,16,18,19) |
| InChIKey | HWEVJVVQXLLTHD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |