C14H14N4O2S — CID 62312013
3-amino-4-[(3-cyanophenyl)methylamino]benzenesulfonamide (PubChem CID 62312013) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-amino-4-[(3-cyanophenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-amino-4-[(3-cyanophenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 62312013 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-amino-4-[(3-cyanophenyl)methylamino]benzenesulfonamide |
| SMILES | N#Cc1cccc(CNc2ccc(S(N)(=O)=O)cc2N)c1 |
| InChI | InChI=1S/C14H14N4O2S/c15-8-10-2-1-3-11(6-10)9-18-14-5-4-12(7-13(14)16)21(17,19)20/h1-7,18H,9,16H2,(H2,17,19,20) |
| InChIKey | RBYLMMGVVYDYQG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|