C13H14ClN3O2S — CID 62538734
3-amino-4-[(3-chlorophenyl)methylamino]benzenesulfonamide (PubChem CID 62538734) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 3-amino-4-[(3-chlorophenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-amino-4-[(3-chlorophenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 62538734 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 3-amino-4-[(3-chlorophenyl)methylamino]benzenesulfonamide |
| SMILES | Nc1cc(S(N)(=O)=O)ccc1NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClN3O2S/c14-10-3-1-2-9(6-10)8-17-13-5-4-11(7-12(13)15)20(16,18)19/h1-7,17H,8,15H2,(H2,16,18,19) |
| InChIKey | QHNSBVXCBPDMLZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|