C17H22ClIN4O2S — CID 111305448
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111305448) has the molecular formula C17H22ClIN4O2S and a molecular weight of 508.81 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111305448 |
| Molecular Formula | C17H22ClIN4O2S |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(S(N)(=O)=O)c1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C17H21ClN4O2S.HI/c1-20-17(22(2)12-14-6-3-7-15(18)9-14)21-11-13-5-4-8-16(10-13)25(19,23)24;/h3-10H,11-12H2,1-2H3,(H,20,21)(H2,19,23,24);1H |
| InChIKey | PLBQIKXLOAEAAO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|