C17H20Cl2N4O2S — CID 111306171
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111306171) has the molecular formula C17H20Cl2N4O2S and a molecular weight of 415.35 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111306171 |
| Molecular Formula | C17H20Cl2N4O2S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(S(N)(=O)=O)c1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N4O2S/c1-21-17(23(2)11-13-6-7-15(18)16(19)9-13)22-10-12-4-3-5-14(8-12)26(20,24)25/h3-9H,10-11H2,1-2H3,(H,21,22)(H2,20,24,25) |
| InChIKey | YNTWWIDJWLAIMX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|