C20H24Cl2N4O2 — CID 111306063
N-[5-[[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide (PubChem CID 111306063) has the molecular formula C20H24Cl2N4O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is N-[5-[[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 111306063 |
| Molecular Formula | C20H24Cl2N4O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[5-[[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide |
| SMILES | C/N=C(/NCc1ccc(OC)c(NC(C)=O)c1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24Cl2N4O2/c1-13(27)25-18-10-14(6-8-19(18)28-4)11-24-20(23-2)26(3)12-15-5-7-16(21)17(22)9-15/h5-10H,11-12H2,1-4H3,(H,23,24)(H,25,27) |
| InChIKey | VGCJDISYSJAYBB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|