C21H29IN4O3 — CID 111271352
N-[2-methoxy-5-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111271352) has the molecular formula C21H29IN4O3 and a molecular weight of 512.39 g/mol. Its IUPAC name is N-[2-methoxy-5-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[2-methoxy-5-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111271352 |
| Molecular Formula | C21H29IN4O3 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | N-[2-methoxy-5-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(NC(C)=O)c1)N(C)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C21H28N4O3.HI/c1-15(26)24-19-12-17(8-11-20(19)28-5)13-23-21(22-2)25(3)14-16-6-9-18(27-4)10-7-16;/h6-12H,13-14H2,1-5H3,(H,22,23)(H,24,26);1H |
| InChIKey | OZAMCFNXEDKIHR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|